About sodium 2-iodononanoate
sodium 2-iodononanoate (PubChem CID 141360284) has the molecular formula C9H16INaO2
and a molecular weight of 306.12 g/mol. Its IUPAC name is sodium 2-iodononanoate.
Molecular Properties
| Compound Name | sodium 2-iodononanoate |
| PubChem CID | 141360284 |
| Molecular Formula | C9H16INaO2 |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | sodium 2-iodononanoate |
| SMILES | CCCCCCCC(I)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H17IO2.Na/c1-2-3-4-5-6-7-8(10)9(11)12;/h8H,2-7H2,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | KRUCLDSQNJMSFV-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-iodononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-iodononanoate?
The IUPAC name of sodium 2-iodononanoate (CID 141360284) is sodium 2-iodononanoate.
What is the SMILES notation for sodium 2-iodononanoate?
The canonical SMILES for sodium 2-iodononanoate is CCCCCCCC(I)C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-iodononanoate?
The InChIKey is KRUCLDSQNJMSFV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H17IO2.Na/c1-2-3-4-5-6-7-8(10)9(11)12;/h8H,2-7H2,1H3,(H,11,12);/q;+1/p-1.
What are the key properties of sodium 2-iodononanoate?
sodium 2-iodononanoate has a molecular weight of 306.12 g/mol, XLogP of -1.10, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-iodononanoate is sourced from PubChem (CID 141360284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).