About magnesium bis(2-methylnonanoate)
magnesium bis(2-methylnonanoate) (PubChem CID 175226104) has the molecular formula C20H38MgO4
and a molecular weight of 366.83 g/mol. Its IUPAC name is magnesium bis(2-methylnonanoate).
Molecular Properties
| Compound Name | magnesium bis(2-methylnonanoate) |
| PubChem CID | 175226104 |
| Molecular Formula | C20H38MgO4 |
| Molecular Weight | 366.83 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | magnesium bis(2-methylnonanoate) |
| SMILES | CCCCCCCC(C)C(=O)[O-].CCCCCCCC(C)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C10H20O2.Mg/c2*1-3-4-5-6-7-8-9(2)10(11)12;/h2*9H,3-8H2,1-2H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | GEWGOVJJZQDLNB-UHFFFAOYSA-L |
| XLogP | 3.09 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.83 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis(2-methylnonanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(2-methylnonanoate)?
The IUPAC name of magnesium bis(2-methylnonanoate) (CID 175226104) is magnesium bis(2-methylnonanoate).
What is the SMILES notation for magnesium bis(2-methylnonanoate)?
The canonical SMILES for magnesium bis(2-methylnonanoate) is CCCCCCCC(C)C(=O)[O-].CCCCCCCC(C)C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(2-methylnonanoate)?
The InChIKey is GEWGOVJJZQDLNB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H20O2.Mg/c2*1-3-4-5-6-7-8-9(2)10(11)12;/h2*9H,3-8H2,1-2H3,(H,11,12);/q;;+2/p-2.
What are the key properties of magnesium bis(2-methylnonanoate)?
magnesium bis(2-methylnonanoate) has a molecular weight of 366.83 g/mol, XLogP of 3.09, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(2-methylnonanoate) is sourced from PubChem (CID 175226104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).