C21H27O2- — CID 22157313
1,1'-biphenyl;2-methyloctanoate (PubChem CID 22157313) has the molecular formula C21H27O2- and a molecular weight of 311.44 g/mol. Its IUPAC name is 1,1'-biphenyl;2-methyloctanoate.
| Compound Name | 1,1'-biphenyl;2-methyloctanoate |
|---|---|
| PubChem CID | 22157313 |
| Molecular Formula | C21H27O2- |
| Molecular Weight | 311.44 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1,1'-biphenyl;2-methyloctanoate |
| SMILES | CCCCCCC(C)C(=O)[O-].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C9H18O2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-4-5-6-7-8(2)9(10)11/h1-10H;8H,3-7H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | LDJBFXWNXDJXLY-UHFFFAOYSA-M |
| XLogP | 4.70 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|