C18H35O3- — CID 59229455
6-hydroxy-2,6,10-trimethylpentadecanoate (PubChem CID 59229455) has the molecular formula C18H35O3- and a molecular weight of 299.48 g/mol. Its IUPAC name is 6-hydroxy-2,6,10-trimethylpentadecanoate.
| Compound Name | 6-hydroxy-2,6,10-trimethylpentadecanoate |
|---|---|
| PubChem CID | 59229455 |
| Molecular Formula | C18H35O3- |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 6-hydroxy-2,6,10-trimethylpentadecanoate |
| SMILES | CCCCCC(C)CCCC(C)(O)CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C18H36O3/c1-5-6-7-10-15(2)11-8-13-18(4,21)14-9-12-16(3)17(19)20/h15-16,21H,5-14H2,1-4H3,(H,19,20)/p-1 |
| InChIKey | KTVUDIOGLVSBQV-UHFFFAOYSA-M |
| XLogP | 3.68 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|