C10H19O3- — CID 59271296
6-hydroxy-2,6-dimethyloctanoate (PubChem CID 59271296) has the molecular formula C10H19O3- and a molecular weight of 187.26 g/mol. Its IUPAC name is 6-hydroxy-2,6-dimethyloctanoate.
| Compound Name | 6-hydroxy-2,6-dimethyloctanoate |
|---|---|
| PubChem CID | 59271296 |
| Molecular Formula | C10H19O3- |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 6-hydroxy-2,6-dimethyloctanoate |
| SMILES | CCC(C)(O)CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C10H20O3/c1-4-10(3,13)7-5-6-8(2)9(11)12/h8,13H,4-7H2,1-3H3,(H,11,12)/p-1 |
| InChIKey | QEGBPMIWVOJJEM-UHFFFAOYSA-M |
| XLogP | 0.70 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |