C11H21O3- — CID 59271392
6-hydroxy-2,6-dimethylnonanoate (PubChem CID 59271392) has the molecular formula C11H21O3- and a molecular weight of 201.29 g/mol. Its IUPAC name is 6-hydroxy-2,6-dimethylnonanoate.
| Compound Name | 6-hydroxy-2,6-dimethylnonanoate |
|---|---|
| PubChem CID | 59271392 |
| Molecular Formula | C11H21O3- |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 6-hydroxy-2,6-dimethylnonanoate |
| SMILES | CCCC(C)(O)CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C11H22O3/c1-4-7-11(3,14)8-5-6-9(2)10(12)13/h9,14H,4-8H2,1-3H3,(H,12,13)/p-1 |
| InChIKey | RUDWPCFQGLOMPH-UHFFFAOYSA-M |
| XLogP | 1.09 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |