About magnesium bis(2-methylpentanoate)
magnesium bis(2-methylpentanoate) (PubChem CID 140813982) has the molecular formula C12H22MgO4
and a molecular weight of 254.61 g/mol. Its IUPAC name is magnesium bis(2-methylpentanoate).
Molecular Properties
| Compound Name | magnesium bis(2-methylpentanoate) |
| PubChem CID | 140813982 |
| Molecular Formula | C12H22MgO4 |
| Molecular Weight | 254.61 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | magnesium bis(2-methylpentanoate) |
| SMILES | CCCC(C)C(=O)[O-].CCCC(C)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C6H12O2.Mg/c2*1-3-4-5(2)6(7)8;/h2*5H,3-4H2,1-2H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | XUIVSVUGZRGQLA-UHFFFAOYSA-L |
| XLogP | -0.04 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.61 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium bis(2-methylpentanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(2-methylpentanoate)?
The IUPAC name of magnesium bis(2-methylpentanoate) (CID 140813982) is magnesium bis(2-methylpentanoate).
What is the SMILES notation for magnesium bis(2-methylpentanoate)?
The canonical SMILES for magnesium bis(2-methylpentanoate) is CCCC(C)C(=O)[O-].CCCC(C)C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(2-methylpentanoate)?
The InChIKey is XUIVSVUGZRGQLA-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H12O2.Mg/c2*1-3-4-5(2)6(7)8;/h2*5H,3-4H2,1-2H3,(H,7,8);/q;;+2/p-2.
What are the key properties of magnesium bis(2-methylpentanoate)?
magnesium bis(2-methylpentanoate) has a molecular weight of 254.61 g/mol, XLogP of -0.04, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(2-methylpentanoate) is sourced from PubChem (CID 140813982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).