About magnesium bis(2-propylpentanoate)
magnesium bis(2-propylpentanoate) (PubChem CID 13327120) has the molecular formula C16H30MgO4
and a molecular weight of 310.72 g/mol. Its IUPAC name is magnesium bis(2-propylpentanoate).
Molecular Properties
| Compound Name | magnesium bis(2-propylpentanoate) |
| PubChem CID | 13327120 |
| Molecular Formula | C16H30MgO4 |
| Molecular Weight | 310.72 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | magnesium bis(2-propylpentanoate) |
| SMILES | CCCC(CCC)C(=O)[O-].CCCC(CCC)C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C8H16O2.Mg/c2*1-3-5-7(6-4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | LKLLHOIUJVEAGU-UHFFFAOYSA-L |
| XLogP | 1.52 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.72 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium bis(2-propylpentanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(2-propylpentanoate)?
The IUPAC name of magnesium bis(2-propylpentanoate) (CID 13327120) is magnesium bis(2-propylpentanoate).
What is the SMILES notation for magnesium bis(2-propylpentanoate)?
The canonical SMILES for magnesium bis(2-propylpentanoate) is CCCC(CCC)C(=O)[O-].CCCC(CCC)C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(2-propylpentanoate)?
The InChIKey is LKLLHOIUJVEAGU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H16O2.Mg/c2*1-3-5-7(6-4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2.
What are the key properties of magnesium bis(2-propylpentanoate)?
magnesium bis(2-propylpentanoate) has a molecular weight of 310.72 g/mol, XLogP of 1.52, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(2-propylpentanoate) is sourced from PubChem (CID 13327120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).