C9H15I3O2 — CID 118275824
3,4,9-triiodonon-1-ene-1,1-diol (PubChem CID 118275824) has the molecular formula C9H15I3O2 and a molecular weight of 535.93 g/mol. Its IUPAC name is 3,4,9-triiodonon-1-ene-1,1-diol.
| Compound Name | 3,4,9-triiodonon-1-ene-1,1-diol |
|---|---|
| PubChem CID | 118275824 |
| Molecular Formula | C9H15I3O2 |
| Molecular Weight | 535.93 g/mol |
| Exact Mass | 535.82 |
| IUPAC Name | 3,4,9-triiodonon-1-ene-1,1-diol |
| SMILES | OC(O)=CC(I)C(I)CCCCCI |
| InChI | InChI=1S/C9H15I3O2/c10-5-3-1-2-4-7(11)8(12)6-9(13)14/h6-8,13-14H,1-5H2 |
| InChIKey | GVVRFPCYNZMAFO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.93 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|