About (1R)-1,11-diiodoundecan-1-amine
(1R)-1,11-diiodoundecan-1-amine (PubChem CID 138602869) has the molecular formula C11H23I2N
and a molecular weight of 423.12 g/mol. Its IUPAC name is (1R)-1,11-diiodoundecan-1-amine.
Molecular Properties
| Compound Name | (1R)-1,11-diiodoundecan-1-amine |
| PubChem CID | 138602869 |
| Molecular Formula | C11H23I2N |
| Molecular Weight | 423.12 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | (1R)-1,11-diiodoundecan-1-amine |
| SMILES | N[C@H](I)CCCCCCCCCCI |
| InChI | InChI=1S/C11H23I2N/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h11H,1-10,14H2/t11-/m0/s1 |
| InChIKey | FLMMHZKRHZFPHO-NSHDSACASA-N |
| XLogP | 4.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.12 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1,11-diiodoundecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1,11-diiodoundecan-1-amine?
The IUPAC name of (1R)-1,11-diiodoundecan-1-amine (CID 138602869) is (1R)-1,11-diiodoundecan-1-amine.
What is the SMILES notation for (1R)-1,11-diiodoundecan-1-amine?
The canonical SMILES for (1R)-1,11-diiodoundecan-1-amine is N[C@H](I)CCCCCCCCCCI.
What is the InChIKey of (1R)-1,11-diiodoundecan-1-amine?
The InChIKey is FLMMHZKRHZFPHO-NSHDSACASA-N. The full InChI is InChI=1S/C11H23I2N/c12-10-8-6-4-2-1-3-5-7-9-11(13)14/h11H,1-10,14H2/t11-/m0/s1.
What are the key properties of (1R)-1,11-diiodoundecan-1-amine?
(1R)-1,11-diiodoundecan-1-amine has a molecular weight of 423.12 g/mol, XLogP of 4.65, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1,11-diiodoundecan-1-amine is sourced from PubChem (CID 138602869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).