About 7-(4-iodobutyl)tridecane
7-(4-iodobutyl)tridecane (PubChem CID 155905887) has the molecular formula C17H35I
and a molecular weight of 366.37 g/mol. Its IUPAC name is 7-(4-iodobutyl)tridecane.
Molecular Properties
| Compound Name | 7-(4-iodobutyl)tridecane |
| PubChem CID | 155905887 |
| Molecular Formula | C17H35I |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 7-(4-iodobutyl)tridecane |
| SMILES | CCCCCCC(CCCCI)CCCCCC |
| InChI | InChI=1S/C17H35I/c1-3-5-7-9-13-17(15-11-12-16-18)14-10-8-6-4-2/h17H,3-16H2,1-2H3 |
| InChIKey | HESUPPYRYJEFIM-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-(4-iodobutyl)tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-iodobutyl)tridecane?
The IUPAC name of 7-(4-iodobutyl)tridecane (CID 155905887) is 7-(4-iodobutyl)tridecane.
What is the SMILES notation for 7-(4-iodobutyl)tridecane?
The canonical SMILES for 7-(4-iodobutyl)tridecane is CCCCCCC(CCCCI)CCCCCC.
What is the InChIKey of 7-(4-iodobutyl)tridecane?
The InChIKey is HESUPPYRYJEFIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35I/c1-3-5-7-9-13-17(15-11-12-16-18)14-10-8-6-4-2/h17H,3-16H2,1-2H3.
What are the key properties of 7-(4-iodobutyl)tridecane?
7-(4-iodobutyl)tridecane has a molecular weight of 366.37 g/mol, XLogP of 7.15, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-iodobutyl)tridecane is sourced from PubChem (CID 155905887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).