C6H11I3O2 — CID 118276244
2,3,6-triiodohexane-1,1-diol (PubChem CID 118276244) has the molecular formula C6H11I3O2 and a molecular weight of 495.86 g/mol. Its IUPAC name is 2,3,6-triiodohexane-1,1-diol.
| Compound Name | 2,3,6-triiodohexane-1,1-diol |
|---|---|
| PubChem CID | 118276244 |
| Molecular Formula | C6H11I3O2 |
| Molecular Weight | 495.86 g/mol |
| Exact Mass | 495.79 |
| IUPAC Name | 2,3,6-triiodohexane-1,1-diol |
| SMILES | OC(O)C(I)C(I)CCCI |
| InChI | InChI=1S/C6H11I3O2/c7-3-1-2-4(8)5(9)6(10)11/h4-6,10-11H,1-3H2 |
| InChIKey | PNBMZCWYLFOZNJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|