C4H7I3O2 — CID 118276281
2,3,4-triiodobutane-1,1-diol (PubChem CID 118276281) has the molecular formula C4H7I3O2 and a molecular weight of 467.81 g/mol. Its IUPAC name is 2,3,4-triiodobutane-1,1-diol.
| Compound Name | 2,3,4-triiodobutane-1,1-diol |
|---|---|
| PubChem CID | 118276281 |
| Molecular Formula | C4H7I3O2 |
| Molecular Weight | 467.81 g/mol |
| Exact Mass | 467.76 |
| IUPAC Name | 2,3,4-triiodobutane-1,1-diol |
| SMILES | OC(O)C(I)C(I)CI |
| InChI | InChI=1S/C4H7I3O2/c5-1-2(6)3(7)4(8)9/h2-4,8-9H,1H2 |
| InChIKey | RVBHTHUTEPOBRT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.81 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|