C4H9IO2 — CID 134856288
(2R,3S)-1-iodobutane-2,3-diol (PubChem CID 134856288) has the molecular formula C4H9IO2 and a molecular weight of 216.02 g/mol. Its IUPAC name is (2R,3S)-1-iodobutane-2,3-diol.
| Compound Name | (2R,3S)-1-iodobutane-2,3-diol |
|---|---|
| PubChem CID | 134856288 |
| Molecular Formula | C4H9IO2 |
| Molecular Weight | 216.02 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | (2R,3S)-1-iodobutane-2,3-diol |
| SMILES | C[C@H](O)[C@@H](O)CI |
| InChI | InChI=1S/C4H9IO2/c1-3(6)4(7)2-5/h3-4,6-7H,2H2,1H3/t3-,4-/m0/s1 |
| InChIKey | DBRFDXRGHGBFCJ-IMJSIDKUSA-N |
| XLogP | 0.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.02 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|