C8H20O4 — CID 161487042
(2R,3R)-butane-2,3-diol;(2R,3S)-butane-2,3-diol (PubChem CID 161487042) has the molecular formula C8H20O4 and a molecular weight of 180.24 g/mol. Its IUPAC name is (2R,3R)-butane-2,3-diol;(2R,3S)-butane-2,3-diol.
| Compound Name | (2R,3R)-butane-2,3-diol;(2R,3S)-butane-2,3-diol |
|---|---|
| PubChem CID | 161487042 |
| Molecular Formula | C8H20O4 |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | (2R,3R)-butane-2,3-diol;(2R,3S)-butane-2,3-diol |
| SMILES | C[C@@H](O)[C@@H](C)O.C[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/2C4H10O2/c2*1-3(5)4(2)6/h2*3-6H,1-2H3/t3-,4+;3-,4-/m.1/s1 |
| InChIKey | WFCLHMCZUVCIHV-NBSXXGRVSA-N |
| XLogP | -0.50 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |