C3H7ClO2 — CID 57125002
(1S)-1-chloropropane-1,2-diol (PubChem CID 57125002) has the molecular formula C3H7ClO2 and a molecular weight of 110.54 g/mol. Its IUPAC name is (1S)-1-chloropropane-1,2-diol.
| Compound Name | (1S)-1-chloropropane-1,2-diol |
|---|---|
| PubChem CID | 57125002 |
| Molecular Formula | C3H7ClO2 |
| Molecular Weight | 110.54 g/mol |
| Exact Mass | 110.01 |
| IUPAC Name | (1S)-1-chloropropane-1,2-diol |
| SMILES | CC(O)[C@@H](O)Cl |
| InChI | InChI=1S/C3H7ClO2/c1-2(5)3(4)6/h2-3,5-6H,1H3/t2?,3-/m1/s1 |
| InChIKey | XFGDAPQOKJYPQP-ZJRLKYRESA-N |
| XLogP | -0.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.54 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|