About 1-chloroethanol;N,N-dimethylmethanamine
1-chloroethanol;N,N-dimethylmethanamine (PubChem CID 87179107) has the molecular formula C5H14ClNO
and a molecular weight of 139.63 g/mol. Its IUPAC name is 1-chloroethanol;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-chloroethanol;N,N-dimethylmethanamine |
| PubChem CID | 87179107 |
| Molecular Formula | C5H14ClNO |
| Molecular Weight | 139.63 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 1-chloroethanol;N,N-dimethylmethanamine |
| SMILES | CC(O)Cl.CN(C)C |
| InChI | InChI=1S/C3H9N.C2H5ClO/c1-4(2)3;1-2(3)4/h1-3H3;2,4H,1H3 |
| InChIKey | IDEUMOSJBJDELE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.63 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroethanol;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroethanol;N,N-dimethylmethanamine?
The IUPAC name of 1-chloroethanol;N,N-dimethylmethanamine (CID 87179107) is 1-chloroethanol;N,N-dimethylmethanamine.
What is the SMILES notation for 1-chloroethanol;N,N-dimethylmethanamine?
The canonical SMILES for 1-chloroethanol;N,N-dimethylmethanamine is CC(O)Cl.CN(C)C.
What is the InChIKey of 1-chloroethanol;N,N-dimethylmethanamine?
The InChIKey is IDEUMOSJBJDELE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.C2H5ClO/c1-4(2)3;1-2(3)4/h1-3H3;2,4H,1H3.
What are the key properties of 1-chloroethanol;N,N-dimethylmethanamine?
1-chloroethanol;N,N-dimethylmethanamine has a molecular weight of 139.63 g/mol, XLogP of 0.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroethanol;N,N-dimethylmethanamine is sourced from PubChem (CID 87179107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).