About chloroform;propan-2-ol
chloroform;propan-2-ol (PubChem CID 173195035) has the molecular formula C7H12Cl12O
and a molecular weight of 537.61 g/mol. Its IUPAC name is chloroform;propan-2-ol.
Molecular Properties
| Compound Name | chloroform;propan-2-ol |
| PubChem CID | 173195035 |
| Molecular Formula | C7H12Cl12O |
| Molecular Weight | 537.61 g/mol |
| Exact Mass | 531.72 |
| IUPAC Name | chloroform;propan-2-ol |
| SMILES | CC(C)O.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl |
| InChI | InChI=1S/C3H8O.4CHCl3/c1-3(2)4;4*2-1(3)4/h3-4H,1-2H3;4*1H |
| InChIKey | QPPVRCNQDRVXKJ-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 537.61 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;propan-2-ol?
The IUPAC name of chloroform;propan-2-ol (CID 173195035) is chloroform;propan-2-ol.
What is the SMILES notation for chloroform;propan-2-ol?
The canonical SMILES for chloroform;propan-2-ol is CC(C)O.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.
What is the InChIKey of chloroform;propan-2-ol?
The InChIKey is QPPVRCNQDRVXKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.4CHCl3/c1-3(2)4;4*2-1(3)4/h3-4H,1-2H3;4*1H.
What are the key properties of chloroform;propan-2-ol?
chloroform;propan-2-ol has a molecular weight of 537.61 g/mol, XLogP of 8.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;propan-2-ol is sourced from PubChem (CID 173195035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).