About aluminum propan-2-ol
aluminum propan-2-ol (PubChem CID 18462529) has the molecular formula C3H8AlO+3
and a molecular weight of 87.08 g/mol. Its IUPAC name is aluminum propan-2-ol.
Molecular Properties
| Compound Name | aluminum propan-2-ol |
| PubChem CID | 18462529 |
| Molecular Formula | C3H8AlO+3 |
| Molecular Weight | 87.08 g/mol |
| Exact Mass | 87.04 |
| IUPAC Name | aluminum propan-2-ol |
| SMILES | CC(C)O.[Al+3] |
| InChI | InChI=1S/C3H8O.Al/c1-3(2)4;/h3-4H,1-2H3;/q;+3 |
| InChIKey | GREVTZBGXWYMSX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 87.08 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze aluminum propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum propan-2-ol?
The IUPAC name of aluminum propan-2-ol (CID 18462529) is aluminum propan-2-ol.
What is the SMILES notation for aluminum propan-2-ol?
The canonical SMILES for aluminum propan-2-ol is CC(C)O.[Al+3].
What is the InChIKey of aluminum propan-2-ol?
The InChIKey is GREVTZBGXWYMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.Al/c1-3(2)4;/h3-4H,1-2H3;/q;+3.
What are the key properties of aluminum propan-2-ol?
aluminum propan-2-ol has a molecular weight of 87.08 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum propan-2-ol is sourced from PubChem (CID 18462529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).