About erbium;propan-2-ol
erbium;propan-2-ol (PubChem CID 160843836) has the molecular formula C3H8ErO
and a molecular weight of 227.36 g/mol. Its IUPAC name is erbium;propan-2-ol.
Molecular Properties
| Compound Name | erbium;propan-2-ol |
| PubChem CID | 160843836 |
| Molecular Formula | C3H8ErO |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 225.99 |
| IUPAC Name | erbium;propan-2-ol |
| SMILES | CC(C)O.[Er] |
| InChI | InChI=1S/C3H8O.Er/c1-3(2)4;/h3-4H,1-2H3; |
| InChIKey | SIJMUBLQCIHDBX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze erbium;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of erbium;propan-2-ol?
The IUPAC name of erbium;propan-2-ol (CID 160843836) is erbium;propan-2-ol.
What is the SMILES notation for erbium;propan-2-ol?
The canonical SMILES for erbium;propan-2-ol is CC(C)O.[Er].
What is the InChIKey of erbium;propan-2-ol?
The InChIKey is SIJMUBLQCIHDBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.Er/c1-3(2)4;/h3-4H,1-2H3;.
What are the key properties of erbium;propan-2-ol?
erbium;propan-2-ol has a molecular weight of 227.36 g/mol, XLogP of 0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for erbium;propan-2-ol is sourced from PubChem (CID 160843836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).