About propan-2-ol;titanium
propan-2-ol;titanium (PubChem CID 25200171) has the molecular formula C3H8OTi
and a molecular weight of 107.96 g/mol. Its IUPAC name is propan-2-ol;titanium.
Molecular Properties
| Compound Name | propan-2-ol;titanium |
| PubChem CID | 25200171 |
| Molecular Formula | C3H8OTi |
| Molecular Weight | 107.96 g/mol |
| Exact Mass | 108.01 |
| IUPAC Name | propan-2-ol;titanium |
| SMILES | CC(C)O.[Ti] |
| InChI | InChI=1S/C3H8O.Ti/c1-3(2)4;/h3-4H,1-2H3; |
| InChIKey | LMCBEWMQFKWHGU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.96 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-ol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;titanium?
The IUPAC name of propan-2-ol;titanium (CID 25200171) is propan-2-ol;titanium.
What is the SMILES notation for propan-2-ol;titanium?
The canonical SMILES for propan-2-ol;titanium is CC(C)O.[Ti].
What is the InChIKey of propan-2-ol;titanium?
The InChIKey is LMCBEWMQFKWHGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.Ti/c1-3(2)4;/h3-4H,1-2H3;.
What are the key properties of propan-2-ol;titanium?
propan-2-ol;titanium has a molecular weight of 107.96 g/mol, XLogP of 0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;titanium is sourced from PubChem (CID 25200171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).