About propan-2-ol;titanium;hydroiodide
propan-2-ol;titanium;hydroiodide (PubChem CID 175242007) has the molecular formula C3H9IOTi
and a molecular weight of 235.88 g/mol. Its IUPAC name is propan-2-ol;titanium;hydroiodide.
Molecular Properties
| Compound Name | propan-2-ol;titanium;hydroiodide |
| PubChem CID | 175242007 |
| Molecular Formula | C3H9IOTi |
| Molecular Weight | 235.88 g/mol |
| Exact Mass | 235.92 |
| IUPAC Name | propan-2-ol;titanium;hydroiodide |
| SMILES | CC(C)O.I.[Ti] |
| InChI | InChI=1S/C3H8O.HI.Ti/c1-3(2)4;;/h3-4H,1-2H3;1H; |
| InChIKey | OWKGUHHFPDJKGL-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.88 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze propan-2-ol;titanium;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ol;titanium;hydroiodide?
The IUPAC name of propan-2-ol;titanium;hydroiodide (CID 175242007) is propan-2-ol;titanium;hydroiodide.
What is the SMILES notation for propan-2-ol;titanium;hydroiodide?
The canonical SMILES for propan-2-ol;titanium;hydroiodide is CC(C)O.I.[Ti].
What is the InChIKey of propan-2-ol;titanium;hydroiodide?
The InChIKey is OWKGUHHFPDJKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.HI.Ti/c1-3(2)4;;/h3-4H,1-2H3;1H;.
What are the key properties of propan-2-ol;titanium;hydroiodide?
propan-2-ol;titanium;hydroiodide has a molecular weight of 235.88 g/mol, XLogP of 1.00, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ol;titanium;hydroiodide is sourced from PubChem (CID 175242007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).