About Indium(III) isopropoxide
Indium(III) isopropoxide (PubChem CID 159258374) has the molecular formula C3H8InO
and a molecular weight of 174.91 g/mol.
Molecular Properties
| Compound Name | Indium(III) isopropoxide |
| PubChem CID | 159258374 |
| Molecular Formula | C3H8InO |
| Molecular Weight | 174.91 g/mol |
| Exact Mass | 174.96 |
| IUPAC Name | — |
| SMILES | CC(C)O.[In] |
| InChI | InChI=1S/C3H8O.In/c1-3(2)4;/h3-4H,1-2H3; |
| InChIKey | OBWNGNXDUVABAS-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.91 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Indium(III) isopropoxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Indium(III) isopropoxide?
The IUPAC name of Indium(III) isopropoxide (CID 159258374) is not available.
What is the SMILES notation for Indium(III) isopropoxide?
The canonical SMILES for Indium(III) isopropoxide is CC(C)O.[In].
What is the InChIKey of Indium(III) isopropoxide?
The InChIKey is OBWNGNXDUVABAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.In/c1-3(2)4;/h3-4H,1-2H3;.
What are the key properties of Indium(III) isopropoxide?
Indium(III) isopropoxide has a molecular weight of 174.91 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Indium(III) isopropoxide is sourced from PubChem (CID 159258374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).