About chloroplatinum;propan-2-ol
chloroplatinum;propan-2-ol (PubChem CID 88713334) has the molecular formula C3H8ClOPt
and a molecular weight of 290.63 g/mol. Its IUPAC name is chloroplatinum;propan-2-ol.
Molecular Properties
| Compound Name | chloroplatinum;propan-2-ol |
| PubChem CID | 88713334 |
| Molecular Formula | C3H8ClOPt |
| Molecular Weight | 290.63 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | chloroplatinum;propan-2-ol |
| SMILES | CC(C)O.Cl[Pt] |
| InChI | InChI=1S/C3H8O.ClH.Pt/c1-3(2)4;;/h3-4H,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | UNLYWZOZVOQZLJ-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.63 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze chloroplatinum;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum;propan-2-ol?
The IUPAC name of chloroplatinum;propan-2-ol (CID 88713334) is chloroplatinum;propan-2-ol.
What is the SMILES notation for chloroplatinum;propan-2-ol?
The canonical SMILES for chloroplatinum;propan-2-ol is CC(C)O.Cl[Pt].
What is the InChIKey of chloroplatinum;propan-2-ol?
The InChIKey is UNLYWZOZVOQZLJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8O.ClH.Pt/c1-3(2)4;;/h3-4H,1-2H3;1H;/q;;+1/p-1.
What are the key properties of chloroplatinum;propan-2-ol?
chloroplatinum;propan-2-ol has a molecular weight of 290.63 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum;propan-2-ol is sourced from PubChem (CID 88713334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).