About beryllium;hydride;propan-2-ol
beryllium;hydride;propan-2-ol (PubChem CID 175546998) has the molecular formula C3H10BeO
and a molecular weight of 71.12 g/mol. Its IUPAC name is beryllium;hydride;propan-2-ol.
Molecular Properties
| Compound Name | beryllium;hydride;propan-2-ol |
| PubChem CID | 175546998 |
| Molecular Formula | C3H10BeO |
| Molecular Weight | 71.12 g/mol |
| Exact Mass | 71.09 |
| IUPAC Name | beryllium;hydride;propan-2-ol |
| SMILES | CC(C)O.[Be+2].[H-].[H-] |
| InChI | InChI=1S/C3H8O.Be.2H/c1-3(2)4;;;/h3-4H,1-2H3;;;/q;+2;2*-1 |
| InChIKey | CXBAXQVLBDWWQZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 71.12 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze beryllium;hydride;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium;hydride;propan-2-ol?
The IUPAC name of beryllium;hydride;propan-2-ol (CID 175546998) is beryllium;hydride;propan-2-ol.
What is the SMILES notation for beryllium;hydride;propan-2-ol?
The canonical SMILES for beryllium;hydride;propan-2-ol is CC(C)O.[Be+2].[H-].[H-].
What is the InChIKey of beryllium;hydride;propan-2-ol?
The InChIKey is CXBAXQVLBDWWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.Be.2H/c1-3(2)4;;;/h3-4H,1-2H3;;;/q;+2;2*-1.
What are the key properties of beryllium;hydride;propan-2-ol?
beryllium;hydride;propan-2-ol has a molecular weight of 71.12 g/mol, XLogP of 0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium;hydride;propan-2-ol is sourced from PubChem (CID 175546998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).