About butane-2,3-diol;propan-2-ol
butane-2,3-diol;propan-2-ol (PubChem CID 88653918) has the molecular formula C7H18O3
and a molecular weight of 150.22 g/mol. Its IUPAC name is butane-2,3-diol;propan-2-ol.
Molecular Properties
| Compound Name | butane-2,3-diol;propan-2-ol |
| PubChem CID | 88653918 |
| Molecular Formula | C7H18O3 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.13 |
| IUPAC Name | butane-2,3-diol;propan-2-ol |
| SMILES | CC(C)O.CC(O)C(C)O |
| InChI | InChI=1S/C4H10O2.C3H8O/c1-3(5)4(2)6;1-3(2)4/h3-6H,1-2H3;3-4H,1-2H3 |
| InChIKey | UPIWLPZJUGHOEV-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze butane-2,3-diol;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2,3-diol;propan-2-ol?
The IUPAC name of butane-2,3-diol;propan-2-ol (CID 88653918) is butane-2,3-diol;propan-2-ol.
What is the SMILES notation for butane-2,3-diol;propan-2-ol?
The canonical SMILES for butane-2,3-diol;propan-2-ol is CC(C)O.CC(O)C(C)O.
What is the InChIKey of butane-2,3-diol;propan-2-ol?
The InChIKey is UPIWLPZJUGHOEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2.C3H8O/c1-3(5)4(2)6;1-3(2)4/h3-6H,1-2H3;3-4H,1-2H3.
What are the key properties of butane-2,3-diol;propan-2-ol?
butane-2,3-diol;propan-2-ol has a molecular weight of 150.22 g/mol, XLogP of 0.14, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2,3-diol;propan-2-ol is sourced from PubChem (CID 88653918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).