C6H14O4 — CID 92527383
(2S,3S,4S,5R)-hexane-2,3,4,5-tetrol (PubChem CID 92527383) has the molecular formula C6H14O4 and a molecular weight of 150.17 g/mol. Its IUPAC name is (2S,3S,4S,5R)-hexane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5R)-hexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 92527383 |
| Molecular Formula | C6H14O4 |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | (2S,3S,4S,5R)-hexane-2,3,4,5-tetrol |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C6H14O4/c1-3(7)5(9)6(10)4(2)8/h3-10H,1-2H3/t3-,4+,5-,6-/m0/s1 |
| InChIKey | TZQPAZWGRJYTLN-FSIIMWSLSA-N |
| XLogP | -1.53 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |