C6H15NO4 — CID 22861300
(2S,3S,4S,5S)-1-aminohexane-2,3,4,5-tetrol (PubChem CID 22861300) has the molecular formula C6H15NO4 and a molecular weight of 165.19 g/mol. Its IUPAC name is (2S,3S,4S,5S)-1-aminohexane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4S,5S)-1-aminohexane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 22861300 |
| Molecular Formula | C6H15NO4 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | (2S,3S,4S,5S)-1-aminohexane-2,3,4,5-tetrol |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CN |
| InChI | InChI=1S/C6H15NO4/c1-3(8)5(10)6(11)4(9)2-7/h3-6,8-11H,2,7H2,1H3/t3-,4-,5-,6-/m0/s1 |
| InChIKey | PKKXIMIVMVHGSA-BXKVDMCESA-N |
| XLogP | -2.59 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |