C8H17NO6 — CID 175926950
[(2S,3S,4S,5S)-2,3,4,5-tetrahydroxyhexyl] 2-aminoacetate (PubChem CID 175926950) has the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. Its IUPAC name is [(2S,3S,4S,5S)-2,3,4,5-tetrahydroxyhexyl] 2-aminoacetate.
| Compound Name | [(2S,3S,4S,5S)-2,3,4,5-tetrahydroxyhexyl] 2-aminoacetate |
|---|---|
| PubChem CID | 175926950 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | [(2S,3S,4S,5S)-2,3,4,5-tetrahydroxyhexyl] 2-aminoacetate |
| SMILES | C[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)COC(=O)CN |
| InChI | InChI=1S/C8H17NO6/c1-4(10)7(13)8(14)5(11)3-15-6(12)2-9/h4-5,7-8,10-11,13-14H,2-3,9H2,1H3/t4-,5-,7-,8-/m0/s1 |
| InChIKey | ZEWLAJUGMAODJD-XVCLALHZSA-N |
| XLogP | -3.05 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |