C11H23NO9 — CID 176891819
(2-aminoacetyl) propanoate;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol (PubChem CID 176891819) has the molecular formula C11H23NO9 and a molecular weight of 313.30 g/mol. Its IUPAC name is (2-aminoacetyl) propanoate;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2-aminoacetyl) propanoate;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 176891819 |
| Molecular Formula | C11H23NO9 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (2-aminoacetyl) propanoate;(2R,3R,4R,5S)-hexane-1,2,3,4,5,6-hexol |
| SMILES | CCC(=O)OC(=O)CN.OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H14O6.C5H9NO3/c7-1-3(9)5(11)6(12)4(10)2-8;1-2-4(7)9-5(8)3-6/h3-12H,1-2H2;2-3,6H2,1H3/t3-,4+,5-,6-;/m1./s1 |
| InChIKey | AXDFXENCQHHMKG-VFQQELCFSA-N |
| XLogP | -4.16 |
| TPSA | 190.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|