C12H23NaO13 — CID 173465428
sodium;hydride;[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 173465428) has the molecular formula C12H23NaO13 and a molecular weight of 398.29 g/mol. Its IUPAC name is sodium;hydride;[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | sodium;hydride;[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 173465428 |
| Molecular Formula | C12H23NaO13 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | sodium;hydride;[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C(OC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.[H-].[Na+] |
| InChI | InChI=1S/C12H22O13.Na.H/c13-1-3(15)5(17)7(19)9(21)11(23)25-12(24)10(22)8(20)6(18)4(16)2-14;;/h3-10,13-22H,1-2H2;;/q;+1;-1/t3-,4-,5-,6-,7+,8+,9-,10-;;/m1../s1 |
| InChIKey | SYMXPPMJAOUUCZ-BYXMFSGCSA-N |
| XLogP | -9.96 |
| TPSA | 245.67 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | -9.96 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|