C11H22O11 — CID 90401514
[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 90401514) has the molecular formula C11H22O11 and a molecular weight of 330.29 g/mol. Its IUPAC name is [(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | [(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 90401514 |
| Molecular Formula | C11H22O11 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C(OC[C@H](O)[C@@H](O)[C@H](O)CO)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H22O11/c12-1-4(14)7(17)6(16)3-22-11(21)10(20)9(19)8(18)5(15)2-13/h4-10,12-20H,1-3H2/t4-,5-,6+,7+,8-,9+,10-/m1/s1 |
| InChIKey | YWRYJALLAMYLBE-BGJVCVCZSA-N |
| XLogP | -5.96 |
| TPSA | 208.37 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | -5.96 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |