C12H22O13 — CID 57190558
(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxo-6-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]hexanoic acid (PubChem CID 57190558) has the molecular formula C12H22O13 and a molecular weight of 374.30 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxo-6-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]hexanoic acid.
| Compound Name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxo-6-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]hexanoic acid |
|---|---|
| PubChem CID | 57190558 |
| Molecular Formula | C12H22O13 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxo-6-[(2R,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexoxy]hexanoic acid |
| SMILES | O=C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H22O13/c13-1-3(14)5(16)6(17)4(15)2-25-12(24)10(21)8(19)7(18)9(20)11(22)23/h3-10,13-21H,1-2H2,(H,22,23)/t3-,4-,5-,6-,7+,8+,9+,10-/m1/s1 |
| InChIKey | PYSCWQDLOIVAFW-OINLFPPZSA-N |
| XLogP | -6.51 |
| TPSA | 245.67 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | -6.51 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |