C12H22O16S — CID 174384269
[(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxysulfonyl (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 174384269) has the molecular formula C12H22O16S and a molecular weight of 454.36 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxysulfonyl (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | [(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxysulfonyl (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 174384269 |
| Molecular Formula | C12H22O16S |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | [(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]oxysulfonyl (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C(OS(=O)(=O)OC(=O)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H22O16S/c13-1-3(15)5(17)7(19)9(21)11(23)27-29(25,26)28-12(24)10(22)8(20)6(18)4(16)2-14/h3-10,13-22H,1-2H2/t3-,4-,5-,6-,7+,8+,9+,10+/m1/s1 |
| InChIKey | ZIJXGSDYHABPEX-XCFDIREASA-N |
| XLogP | -7.81 |
| TPSA | 289.04 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | -7.81 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |