C6H13O10P — CID 87139786
phosphono (2R,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 87139786) has the molecular formula C6H13O10P and a molecular weight of 276.13 g/mol. Its IUPAC name is phosphono (2R,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | phosphono (2R,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 87139786 |
| Molecular Formula | C6H13O10P |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | phosphono (2R,3R,4S,5S)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C(OP(=O)(O)O)[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C6H13O10P/c7-1-2(8)3(9)4(10)5(11)6(12)16-17(13,14)15/h2-5,7-11H,1H2,(H2,13,14,15)/t2-,3-,4+,5+/m0/s1 |
| InChIKey | IMLGFCBIORERST-QMKXCQHVSA-N |
| XLogP | -3.94 |
| TPSA | 184.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | -3.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|