C6H14O14P2 — CID 88507954
phosphono (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-6-phosphonooxyhexanoate (PubChem CID 88507954) has the molecular formula C6H14O14P2 and a molecular weight of 372.11 g/mol. Its IUPAC name is phosphono (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-6-phosphonooxyhexanoate.
| Compound Name | phosphono (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-6-phosphonooxyhexanoate |
|---|---|
| PubChem CID | 88507954 |
| Molecular Formula | C6H14O14P2 |
| Molecular Weight | 372.11 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | phosphono (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxy-6-phosphonooxyhexanoate |
| SMILES | O=C(OP(=O)(O)O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H](O)C(O)OP(=O)(O)O |
| InChI | InChI=1S/C6H14O14P2/c7-1(3(9)5(11)19-21(13,14)15)2(8)4(10)6(12)20-22(16,17)18/h1-5,7-11H,(H2,13,14,15)(H2,16,17,18)/t1-,2+,3-,4-,5?/m1/s1 |
| InChIKey | GNQKKCWZJCCYGN-VGASXLIASA-N |
| XLogP | -4.51 |
| TPSA | 251.74 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.11 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|