C4H11O8P — CID 174690101
[(2S,3S)-1,2,3,4-tetrahydroxybutyl] dihydrogen phosphate (PubChem CID 174690101) has the molecular formula C4H11O8P and a molecular weight of 218.10 g/mol. Its IUPAC name is [(2S,3S)-1,2,3,4-tetrahydroxybutyl] dihydrogen phosphate.
| Compound Name | [(2S,3S)-1,2,3,4-tetrahydroxybutyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 174690101 |
| Molecular Formula | C4H11O8P |
| Molecular Weight | 218.10 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | [(2S,3S)-1,2,3,4-tetrahydroxybutyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OC(O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C4H11O8P/c5-1-2(6)3(7)4(8)12-13(9,10)11/h2-8H,1H2,(H2,9,10,11)/t2-,3-,4?/m0/s1 |
| InChIKey | YZXAJXHTEVZWPS-LPGMDIISSA-N |
| XLogP | -2.87 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.10 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|