C12H25O15P — CID 160529298
(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] dihydrogen phosphate (PubChem CID 160529298) has the molecular formula C12H25O15P and a molecular weight of 440.29 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] dihydrogen phosphate.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 160529298 |
| Molecular Formula | C12H25O15P |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] dihydrogen phosphate |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C[C@H](OP(=O)(O)O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H13O9P.C6H12O6/c7-1-3(9)5(10)6(11)4(2-8)15-16(12,13)14;7-1-3(9)5(11)6(12)4(10)2-8/h2-7,9-11H,1H2,(H2,12,13,14);1,3-6,8-12H,2H2/t3-,4+,5-,6-;3-,4+,5+,6+/m10/s1 |
| InChIKey | QVHZQKSGJJTXBO-NYRIJBPWSA-N |
| XLogP | -6.64 |
| TPSA | 282.97 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | -6.64 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|