C6H14O12P2 — CID 21155772
[(2R,3S,4S,5R)-4,5,6-trihydroxy-1-oxo-2-phosphonooxyhexan-3-yl] dihydrogen phosphate (PubChem CID 21155772) has the molecular formula C6H14O12P2 and a molecular weight of 340.11 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-4,5,6-trihydroxy-1-oxo-2-phosphonooxyhexan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4S,5R)-4,5,6-trihydroxy-1-oxo-2-phosphonooxyhexan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 21155772 |
| Molecular Formula | C6H14O12P2 |
| Molecular Weight | 340.11 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | [(2R,3S,4S,5R)-4,5,6-trihydroxy-1-oxo-2-phosphonooxyhexan-3-yl] dihydrogen phosphate |
| SMILES | O=C[C@H](OP(=O)(O)O)[C@@H](OP(=O)(O)O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H14O12P2/c7-1-3(9)5(10)6(18-20(14,15)16)4(2-8)17-19(11,12)13/h2-7,9-10H,1H2,(H2,11,12,13)(H2,14,15,16)/t3-,4+,5+,6-/m1/s1 |
| InChIKey | FHGTVVURHLJINA-DPYQTVNSSA-N |
| XLogP | -3.14 |
| TPSA | 211.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.11 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|