C12H23O14P — CID 87912577
[(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen phosphate (PubChem CID 87912577) has the molecular formula C12H23O14P and a molecular weight of 422.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 87912577 |
| Molecular Formula | C12H23O14P |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl] [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] hydrogen phosphate |
| SMILES | O=C[C@H](OP(=O)(O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H23O14P/c13-1-5(16)9(19)11(21)7(18)4-25-27(23,24)26-8(3-15)12(22)10(20)6(17)2-14/h1,3,5-12,14,16-22H,2,4H2,(H,23,24)/t5-,6+,7+,8-,9+,10+,11+,12+/m0/s1 |
| InChIKey | MJBYRJIQBDQRMP-WQOUGCNASA-N |
| XLogP | -5.59 |
| TPSA | 251.74 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | -5.59 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|