C12H25O16P — CID 175010612
2,3,4,5,6-pentahydroxyhexanoic acid;(2,3,4,5-tetrahydroxy-6-oxohexyl) dihydrogen phosphate (PubChem CID 175010612) has the molecular formula C12H25O16P and a molecular weight of 456.29 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxyhexanoic acid;(2,3,4,5-tetrahydroxy-6-oxohexyl) dihydrogen phosphate.
| Compound Name | 2,3,4,5,6-pentahydroxyhexanoic acid;(2,3,4,5-tetrahydroxy-6-oxohexyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 175010612 |
| Molecular Formula | C12H25O16P |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | 2,3,4,5,6-pentahydroxyhexanoic acid;(2,3,4,5-tetrahydroxy-6-oxohexyl) dihydrogen phosphate |
| SMILES | O=C(O)C(O)C(O)C(O)C(O)CO.O=CC(O)C(O)C(O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C6H13O9P.C6H12O7/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;7-1-2(8)3(9)4(10)5(11)6(12)13/h1,3-6,8-11H,2H2,(H2,12,13,14);2-5,7-11H,1H2,(H,12,13) |
| InChIKey | CMFMFAADUVXOHO-UHFFFAOYSA-N |
| XLogP | -6.75 |
| TPSA | 303.20 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | -6.75 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|