C10H18O12 — CID 161465401
2,3-dihydroxybutanedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal (PubChem CID 161465401) has the molecular formula C10H18O12 and a molecular weight of 330.24 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal.
| Compound Name | 2,3-dihydroxybutanedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
|---|---|
| PubChem CID | 161465401 |
| Molecular Formula | C10H18O12 |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O6.C4H6O6/c7-1-3(9)5(11)6(12)4(10)2-8;5-1(3(7)8)2(6)4(9)10/h1,3-6,8-12H,2H2;1-2,5-6H,(H,7,8)(H,9,10)/t3-,4+,5+,6+;/m0./s1 |
| InChIKey | WCJAEFHIYXJSOL-BTVCFUMJSA-N |
| XLogP | -5.50 |
| TPSA | 233.28 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | -5.50 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|