C23H44O24 — CID 158898171
bis((2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal);(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 158898171) has the molecular formula C23H44O24 and a molecular weight of 704.58 g/mol. Its IUPAC name is bis((2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal);(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | bis((2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal);(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 158898171 |
| Molecular Formula | C23H44O24 |
| Molecular Weight | 704.58 g/mol |
| Exact Mass | 704.22 |
| IUPAC Name | bis((2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanal);(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid;(2R,3S,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C6H10O7.2C6H12O6.C5H10O5/c7-1-2(8)3(9)4(10)5(11)6(12)13;2*7-1-3(9)5(11)6(12)4(10)2-8;6-1-3(8)5(10)4(9)2-7/h1-5,8-11H,(H,12,13);2*1,3-6,8-12H,2H2;1,3-5,7-10H,2H2/t2-,3+,4-,5-;2*3-,4+,5+,6-;3-,4+,5+/m0000/s1 |
| InChIKey | JFCDZODIIMGMSH-GROIJBCJSA-N |
| XLogP | -12.78 |
| TPSA | 469.72 Ų |
| H-Bond Donors | 19 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.58 |
| LogP ≤ 5 | -12.78 |
| H-Bond Donors ≤ 5 | 19 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|