C12H22O13 — CID 87378540
(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 87378540) has the molecular formula C12H22O13 and a molecular weight of 374.30 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 87378540 |
| Molecular Formula | C12H22O13 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal;(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | O=C[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO.O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C6H10O7.C6H12O6/c7-1-2(8)3(9)4(10)5(11)6(12)13;7-1-3(9)5(11)6(12)4(10)2-8/h1-5,8-11H,(H,12,13);1,3-6,8-12H,2H2/t2-,3+,4+,5-;3-,4-,5-,6-/m01/s1 |
| InChIKey | WWWRVNIMESULDO-ORGIXOCPSA-N |
| XLogP | -6.67 |
| TPSA | 253.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | -6.67 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|