C5H11O9P — CID 3283969
2,3,4-trihydroxy-5-phosphonooxypentanoic acid (PubChem CID 3283969) has the molecular formula C5H11O9P and a molecular weight of 246.11 g/mol. Its IUPAC name is 2,3,4-trihydroxy-5-phosphonooxypentanoic acid.
| Compound Name | 2,3,4-trihydroxy-5-phosphonooxypentanoic acid |
|---|---|
| PubChem CID | 3283969 |
| Molecular Formula | C5H11O9P |
| Molecular Weight | 246.11 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 2,3,4-trihydroxy-5-phosphonooxypentanoic acid |
| SMILES | O=C(O)C(O)C(O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C5H11O9P/c6-2(1-14-15(11,12)13)3(7)4(8)5(9)10/h2-4,6-8H,1H2,(H,9,10)(H2,11,12,13) |
| InChIKey | HNECGPFIYSOYHF-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.11 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|