C6H12FO9P — CID 175056862
(6-fluoro-2,3,4,5-tetrahydroxy-6-oxohexyl) dihydrogen phosphate (PubChem CID 175056862) has the molecular formula C6H12FO9P and a molecular weight of 278.13 g/mol. Its IUPAC name is (6-fluoro-2,3,4,5-tetrahydroxy-6-oxohexyl) dihydrogen phosphate.
| Compound Name | (6-fluoro-2,3,4,5-tetrahydroxy-6-oxohexyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 175056862 |
| Molecular Formula | C6H12FO9P |
| Molecular Weight | 278.13 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | (6-fluoro-2,3,4,5-tetrahydroxy-6-oxohexyl) dihydrogen phosphate |
| SMILES | O=C(F)C(O)C(O)C(O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C6H12FO9P/c7-6(12)5(11)4(10)3(9)2(8)1-16-17(13,14)15/h2-5,8-11H,1H2,(H2,13,14,15) |
| InChIKey | DMAOSHHCZKJFDM-UHFFFAOYSA-N |
| XLogP | -2.96 |
| TPSA | 164.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.13 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|