C6H16NO8P — CID 175109402
(6-amino-2,3,4,5-tetrahydroxyhexyl) dihydrogen phosphate (PubChem CID 175109402) has the molecular formula C6H16NO8P and a molecular weight of 261.17 g/mol. Its IUPAC name is (6-amino-2,3,4,5-tetrahydroxyhexyl) dihydrogen phosphate.
| Compound Name | (6-amino-2,3,4,5-tetrahydroxyhexyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 175109402 |
| Molecular Formula | C6H16NO8P |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | (6-amino-2,3,4,5-tetrahydroxyhexyl) dihydrogen phosphate |
| SMILES | NCC(O)C(O)C(O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C6H16NO8P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3-6,8-11H,1-2,7H2,(H2,12,13,14) |
| InChIKey | FXSITFSMSOXPHT-UHFFFAOYSA-N |
| XLogP | -3.50 |
| TPSA | 173.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | -3.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|