C6H14NO8P — CID 45109785
[(3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate (PubChem CID 45109785) has the molecular formula C6H14NO8P and a molecular weight of 259.15 g/mol. Its IUPAC name is [(3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate.
| Compound Name | [(3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 45109785 |
| Molecular Formula | C6H14NO8P |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | [(3S,4R,5R)-5-amino-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate |
| SMILES | N[C@@H](C=O)[C@@H](O)[C@H](O)C(O)COP(=O)(O)O |
| InChI | InChI=1S/C6H14NO8P/c7-3(1-8)5(10)6(11)4(9)2-15-16(12,13)14/h1,3-6,9-11H,2,7H2,(H2,12,13,14)/t3-,4?,5+,6+/m0/s1 |
| InChIKey | AEJSSXDYDSUOOZ-UQIFEBIISA-N |
| XLogP | -3.30 |
| TPSA | 170.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|