C6H12ClO8P — CID 87935756
[(2R,3R,4S,5S)-5-chloro-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate (PubChem CID 87935756) has the molecular formula C6H12ClO8P and a molecular weight of 278.58 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-5-chloro-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate.
| Compound Name | [(2R,3R,4S,5S)-5-chloro-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87935756 |
| Molecular Formula | C6H12ClO8P |
| Molecular Weight | 278.58 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | [(2R,3R,4S,5S)-5-chloro-2,3,4-trihydroxy-6-oxohexyl] dihydrogen phosphate |
| SMILES | O=C[C@@H](Cl)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C6H12ClO8P/c7-3(1-8)5(10)6(11)4(9)2-15-16(12,13)14/h1,3-6,9-11H,2H2,(H2,12,13,14)/t3-,4-,5-,6-/m1/s1 |
| InChIKey | GJZZWPRIJGJZRI-KVTDHHQDSA-N |
| XLogP | -2.02 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.58 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|