C6H15KO10P — CID 156594754
CID 156594754 (PubChem CID 156594754) has the molecular formula C6H15KO10P and a molecular weight of 317.25 g/mol.
| Compound Name | CID 156594754 |
|---|---|
| PubChem CID | 156594754 |
| Molecular Formula | C6H15KO10P |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | — |
| SMILES | O.O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)COP(=O)(O)O.[K] |
| InChI | InChI=1S/C6H13O9P.K.H2O/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;;/h1,3-6,8-11H,2H2,(H2,12,13,14);;1H2/t3-,4+,5+,6+;;/m0../s1 |
| InChIKey | VUTHNBFQDYDDJK-FAOVPRGRSA-N |
| XLogP | -4.47 |
| TPSA | 196.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|